IUPAC Name | |
---|---|
Alternative Names | Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE Trisulfurated phosphorus Phosphorous sesquisulfide Tetraphosphorus trisulphide |
Molecular Formula | P4S3 |
Molar Mass | 220.075 g/mol |
InChI | InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2 |
What are the rules for naming compounds?
- Alkanes - saturated hydrocarbons The names of the straight chain saturated hydrocarbons for up to a 12 carbon chain are shown below. ...
- Alkyl halides The halogen is treated as a substituent on an alkane chain. ...
- Alkenes and Alkynes - unsaturated hydrocarbons Double bonds in hydrocarbons are indicated by replacing the suffix -ane with -ene . ...
What is the compound name for PO4 3?
PO4(3-) CREATINE PHOSPHATE;N-PHOSPHOCREATINE [PO4](3-) [O-]P([O-])([O-])=O. Q177811. Phosphate, Ion chromatography standard solution, Specpure, PO4-? 1000?g/ml
What is the formula for dinitrogen pentasulfide?
What would the formula of diiodine pentasulfide be? ... The compound dinitrogen trioxide would have the chemical formula. 2O3. The correct name for SO is _____.
What are the systematic names of these compounds?
Sometimes these compounds have generic or common names (e.g., H2O is "water") and they also have systematic names (e.g., H2O, dihydrogen monoxide). The common name must be memorized. The systematic name is more complicated but it has the advantage that the formula of the compound can be deduced from the name.
What is correct name for P4S3?
PHOSPHORUS SESQUISULFIDE TetraphosphorusPhosphorus sesquisulfidePubChem CID14818Chemical SafetyLaboratory Chemical Safety Summary (LCSS) DatasheetMolecular FormulaP4S3SynonymsPHOSPHORUS SESQUISULFIDE Tetraphosphorus trisulfide 1314-85-8 UNII-8V5Q0M194Y P4S3 More...Molecular Weight220.13 more rows
What is the correct name for pcl5?
Phosphorus pentachloridePhosphorus(V) chloridePhosphorus pentachloride/IUPAC ID
What is the name of P4S7?
Phosphorus sulfide (P4S7)Structure Notation TypeNotationSMILESP12SP3SP(S1)SP(=S)(S2)S3INCHIInChI=1S/P4S7/c5-4-9-1-6-2(10-4)8-3(7-1)11-418-Jan-2022
What is the name of P4O6?
Phosphorus trioxidePhosphorus trioxide is the chemical compound with the molecular formula P4O6. Although the molecular formula suggests the name tetraphosphorus hexoxide, the name phosphorus trioxide preceded the knowledge of the compound's molecular structure, and its usage continues today.05-Mar-2012
What is the name of the compound with the formula p4o10?
tricyclo[3.3.1.13,7]tetraphosphoxane 1,3,5,7-tetraoxidePhosphorus pentoxide / IUPAC ID
What is the name of the compound with the formula n2o4?
Dinitrogen TetraoxideDinitrogen tetroxide / IUPAC ID
What is the molecular formula of P2O3?
P₄O₆Phosphorus trioxide / Formula
What is the compound name of Rb2O?
Rubidium oxideRubidium oxide (Rb2O)
What is the name of the formula Mg3 PO4 2?
Magnesium phosphateMagnesium phosphate | Mg3(PO4)2 - PubChem.
What is the name of the compound with the formula As2O5?
What is the name for the compound with the formula As2O5? The name for As2O5 is diarsenic pentoxide. The chemical symbol for arsenic is "As" and since there are two arsenic atoms, the di- prefix must be used. The five oxygens in the formula are indicated by the penta- prefix.
What is the name of P2O5?
The name for P2O5 is diphosphorus pentoxide. There is more than one of each element in the compound so prefixes must be used for both elements, which eliminates phosphorus pentoxide and phosphorus oxide as possible names.
What is the name of the tetraphosphorus trisulfide?
The name for P4S3 is tetraphosphorus trisulfide. Tetraphosphorus indicates that there are four atoms of phosphorus and trisulfide represents the three atoms of sulfur. The formula for triphosphorus tetrasulfide is P3S4 and PS3 is the formula phosphorus trisulfide.
What is the formula for tetraboron decahydride?
The formula for tetraboron decahydride is B4H10. The prefix tetra- indicates four atoms of boron and deca- before hydride means there are ten atoms of hydrogen. One of the uses of hydrazine, N2H4, is as a rocket fuel.
What is the prefix for CBR4?
What is the name for the compound with the formula CBr4? The name for CBr4 is carbon tetrabromide. The prefix for carbon is omitted because there is only one atom of carbon.
What is the name of the molecule B2H6?
The name for B2H6 is diboron hexahydride. The prefix di- is used to indicate the two atoms of boron and hexa- indicates the six atoms of hydrogen. The formula for diboron heptahydride is B2H7. The prefix tri-, used in triboron hexhydride (B3H6) and triboron heptahydride (B3H7) indicates three atoms of boron which does not match the given formula.
What is the symbol for laughing gas?
The symbol for argon is "Ar", and as a noble gas, it does not form covalent compounds. The formula for laughing gas is N2O.
